ChemNet > CAS > 118337-33-0 2-bromo-1- (3-metilbenzo [b] tiyofen-2-il) etan-1-on
118337-33-0 2-bromo-1- (3-metilbenzo [b] tiyofen-2-il) etan-1-on
| Ürün Adı |
2-bromo-1- (3-metilbenzo [b] tiyofen-2-il) etan-1-on |
| Eş anlamlı |
2-bromo-1- (3-metil-1-benzotiyofen-2-il) etanon; 2-bromo-1- (5-kloro-3-metil-1-benzotiyofen-2-il) etanon;
|
| ingilizce adı |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one;2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| Moleküler Formülü |
C11H8BrClOS |
| Molekül Ağırlığı |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| CAS kayıt numarası |
118337-33-0 |
| Moleküler Yapısı |
![118337-33-0 2-bromo-1- (3-metilbenzo [b] tiyofen-2-il) etan-1-on](https://images-a.chemnet.com/suppliers/chembase/348/34859.gif)
|
| Yoğunluk |
1.632g/cm3 |
| Ergime noktası |
94℃ |
| Kaynama noktası |
396.2°C at 760 mmHg |
| Kırılma indisi |
1.676 |
| Alevlenme noktası |
193.4°C |
| Buhar basıncı |
1.73E-06mmHg at 25°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
